C56H58N4O3 — CID 158202175
4,5-diphenyl-1,3-oxazole-2-carbaldehyde;1-(4,5-diphenyl-1,3-oxazol-2-yl)-N-[2,6-di(propan-2-yl)phenyl]methanimine;2,6-di(propan-2-yl)aniline (PubChem CID 158202175) has the molecular formula C56H58N4O3 and a molecular weight of 835.11 g/mol. Its IUPAC name is 4,5-diphenyl-1,3-oxazole-2-carbaldehyde;1-(4,5-diphenyl-1,3-oxazol-2-yl)-N-[2,6-di(propan-2-yl)phenyl]methanimine;2,6-di(propan-2-yl)aniline.
| Compound Name | 4,5-diphenyl-1,3-oxazole-2-carbaldehyde;1-(4,5-diphenyl-1,3-oxazol-2-yl)-N-[2,6-di(propan-2-yl)phenyl]methanimine;2,6-di(propan-2-yl)aniline |
|---|---|
| PubChem CID | 158202175 |
| Molecular Formula | C56H58N4O3 |
| Molecular Weight | 835.11 g/mol |
| Exact Mass | 834.45 |
| IUPAC Name | 4,5-diphenyl-1,3-oxazole-2-carbaldehyde;1-(4,5-diphenyl-1,3-oxazol-2-yl)-N-[2,6-di(propan-2-yl)phenyl]methanimine;2,6-di(propan-2-yl)aniline |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C/c1nc(-c2ccccc2)c(-c2ccccc2)o1.CC(C)c1cccc(C(C)C)c1N.O=Cc1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C28H28N2O.C16H11NO2.C12H19N/c1-19(2)23-16-11-17-24(20(3)4)27(23)29-18-25-30-26(21-12-7-5-8-13-21)28(31-25)22-14-9-6-10-15-22;18-11-14-17-15(12-7-3-1-4-8-12)16(19-14)13-9-5-2-6-10-13;1-8(2)10-6-5-7-11(9(3)4)12(10)13/h5-20H,1-4H3;1-11H;5-9H,13H2,1-4H3/b29-18+;; |
| InChIKey | GBBMWTWWGMINOP-ROCHPHFTSA-N |
| XLogP | 15.34 |
| TPSA | 107.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.11 |
| LogP ≤ 5 | 15.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|