C25H25Cl2FN2O2 — CID 158203487
(3,4-dichlorophenyl)-[4-fluoro-4-(4-quinolin-8-yloxybutyl)piperidin-1-yl]methanone (PubChem CID 158203487) has the molecular formula C25H25Cl2FN2O2 and a molecular weight of 475.39 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-[4-fluoro-4-(4-quinolin-8-yloxybutyl)piperidin-1-yl]methanone.
| Compound Name | (3,4-dichlorophenyl)-[4-fluoro-4-(4-quinolin-8-yloxybutyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 158203487 |
| Molecular Formula | C25H25Cl2FN2O2 |
| Molecular Weight | 475.39 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | (3,4-dichlorophenyl)-[4-fluoro-4-(4-quinolin-8-yloxybutyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(Cl)c(Cl)c1)N1CCC(F)(CCCCOc2cccc3cccnc23)CC1 |
| InChI | InChI=1S/C25H25Cl2FN2O2/c26-20-9-8-19(17-21(20)27)24(31)30-14-11-25(28,12-15-30)10-1-2-16-32-22-7-3-5-18-6-4-13-29-23(18)22/h3-9,13,17H,1-2,10-12,14-16H2 |
| InChIKey | QZEKIXHOXKPQHA-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.39 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|