C48H49N7O8 — CID 158206703
2-[(4-methoxyphenoxy)carbonyl-[[3-[3-(5-methyl-2-phenyltriazol-4-yl)propoxy]phenyl]methyl]amino]acetic acid;3-[3-(5-methyl-2-phenyltriazol-4-yl)propoxy]benzaldehyde (PubChem CID 158206703) has the molecular formula C48H49N7O8 and a molecular weight of 851.96 g/mol. Its IUPAC name is 2-[(4-methoxyphenoxy)carbonyl-[[3-[3-(5-methyl-2-phenyltriazol-4-yl)propoxy]phenyl]methyl]amino]acetic acid;3-[3-(5-methyl-2-phenyltriazol-4-yl)propoxy]benzaldehyde.
| Compound Name | 2-[(4-methoxyphenoxy)carbonyl-[[3-[3-(5-methyl-2-phenyltriazol-4-yl)propoxy]phenyl]methyl]amino]acetic acid;3-[3-(5-methyl-2-phenyltriazol-4-yl)propoxy]benzaldehyde |
|---|---|
| PubChem CID | 158206703 |
| Molecular Formula | C48H49N7O8 |
| Molecular Weight | 851.96 g/mol |
| Exact Mass | 851.36 |
| IUPAC Name | 2-[(4-methoxyphenoxy)carbonyl-[[3-[3-(5-methyl-2-phenyltriazol-4-yl)propoxy]phenyl]methyl]amino]acetic acid;3-[3-(5-methyl-2-phenyltriazol-4-yl)propoxy]benzaldehyde |
| SMILES | COc1ccc(OC(=O)N(CC(=O)O)Cc2cccc(OCCCc3nn(-c4ccccc4)nc3C)c2)cc1.Cc1nn(-c2ccccc2)nc1CCCOc1cccc(C=O)c1 |
| InChI | InChI=1S/C29H30N4O6.C19H19N3O2/c1-21-27(31-33(30-21)23-9-4-3-5-10-23)12-7-17-38-26-11-6-8-22(18-26)19-32(20-28(34)35)29(36)39-25-15-13-24(37-2)14-16-25;1-15-19(21-22(20-15)17-8-3-2-4-9-17)11-6-12-24-18-10-5-7-16(13-18)14-23/h3-6,8-11,13-16,18H,7,12,17,19-20H2,1-2H3,(H,34,35);2-5,7-10,13-14H,6,11-12H2,1H3 |
| InChIKey | GBOUSRABJLPGDN-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 173.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.96 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|