C26H24N4O4 — CID 20770904
2-[benzoyl-[[3-[(5-methyl-2-phenyltriazol-4-yl)methoxy]phenyl]methyl]amino]acetic acid (PubChem CID 20770904) has the molecular formula C26H24N4O4 and a molecular weight of 456.50 g/mol. Its IUPAC name is 2-[benzoyl-[[3-[(5-methyl-2-phenyltriazol-4-yl)methoxy]phenyl]methyl]amino]acetic acid.
| Compound Name | 2-[benzoyl-[[3-[(5-methyl-2-phenyltriazol-4-yl)methoxy]phenyl]methyl]amino]acetic acid |
|---|---|
| PubChem CID | 20770904 |
| Molecular Formula | C26H24N4O4 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 2-[benzoyl-[[3-[(5-methyl-2-phenyltriazol-4-yl)methoxy]phenyl]methyl]amino]acetic acid |
| SMILES | Cc1nn(-c2ccccc2)nc1COc1cccc(CN(CC(=O)O)C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C26H24N4O4/c1-19-24(28-30(27-19)22-12-6-3-7-13-22)18-34-23-14-8-9-20(15-23)16-29(17-25(31)32)26(33)21-10-4-2-5-11-21/h2-15H,16-18H2,1H3,(H,31,32) |
| InChIKey | QTWVZRYNWHCBLM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |