About O-propyl propanethioate
O-propyl propanethioate (PubChem CID 15820857) has the molecular formula C6H12OS
and a molecular weight of 132.23 g/mol. Its IUPAC name is O-propyl propanethioate.
Molecular Properties
| Compound Name | O-propyl propanethioate |
| PubChem CID | 15820857 |
| Molecular Formula | C6H12OS |
| Molecular Weight | 132.23 g/mol |
| Exact Mass | 132.06 |
| IUPAC Name | O-propyl propanethioate |
| SMILES | CCCOC(=S)CC |
| InChI | InChI=1S/C6H12OS/c1-3-5-7-6(8)4-2/h3-5H2,1-2H3 |
| InChIKey | LJPQPOPWEZOQGU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.23 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-propyl propanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-propyl propanethioate?
The IUPAC name of O-propyl propanethioate (CID 15820857) is O-propyl propanethioate.
What is the SMILES notation for O-propyl propanethioate?
The canonical SMILES for O-propyl propanethioate is CCCOC(=S)CC.
What is the InChIKey of O-propyl propanethioate?
The InChIKey is LJPQPOPWEZOQGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12OS/c1-3-5-7-6(8)4-2/h3-5H2,1-2H3.
What are the key properties of O-propyl propanethioate?
O-propyl propanethioate has a molecular weight of 132.23 g/mol, XLogP of 2.15, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for O-propyl propanethioate is sourced from PubChem (CID 15820857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).