About 3-iodo-1-(oxetan-3-yl)pyrazole;5-iodo-1H-pyrazole
3-iodo-1-(oxetan-3-yl)pyrazole;5-iodo-1H-pyrazole (PubChem CID 158209715) has the molecular formula C9H10I2N4O
and a molecular weight of 444.01 g/mol. Its IUPAC name is 3-iodo-1-(oxetan-3-yl)pyrazole;5-iodo-1H-pyrazole.
Molecular Properties
| Compound Name | 3-iodo-1-(oxetan-3-yl)pyrazole;5-iodo-1H-pyrazole |
| PubChem CID | 158209715 |
| Molecular Formula | C9H10I2N4O |
| Molecular Weight | 444.01 g/mol |
| Exact Mass | 443.89 |
| IUPAC Name | 3-iodo-1-(oxetan-3-yl)pyrazole;5-iodo-1H-pyrazole |
| SMILES | Ic1ccn(C2COC2)n1.Ic1ccn[nH]1 |
| InChI | InChI=1S/C6H7IN2O.C3H3IN2/c7-6-1-2-9(8-6)5-3-10-4-5;4-3-1-2-5-6-3/h1-2,5H,3-4H2;1-2H,(H,5,6) |
| InChIKey | GBXSALUQSOAFDX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.01 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-1-(oxetan-3-yl)pyrazole;5-iodo-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-1-(oxetan-3-yl)pyrazole;5-iodo-1H-pyrazole?
The IUPAC name of 3-iodo-1-(oxetan-3-yl)pyrazole;5-iodo-1H-pyrazole (CID 158209715) is 3-iodo-1-(oxetan-3-yl)pyrazole;5-iodo-1H-pyrazole.
What is the SMILES notation for 3-iodo-1-(oxetan-3-yl)pyrazole;5-iodo-1H-pyrazole?
The canonical SMILES for 3-iodo-1-(oxetan-3-yl)pyrazole;5-iodo-1H-pyrazole is Ic1ccn(C2COC2)n1.Ic1ccn[nH]1.
What is the InChIKey of 3-iodo-1-(oxetan-3-yl)pyrazole;5-iodo-1H-pyrazole?
The InChIKey is GBXSALUQSOAFDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7IN2O.C3H3IN2/c7-6-1-2-9(8-6)5-3-10-4-5;4-3-1-2-5-6-3/h1-2,5H,3-4H2;1-2H,(H,5,6).
What are the key properties of 3-iodo-1-(oxetan-3-yl)pyrazole;5-iodo-1H-pyrazole?
3-iodo-1-(oxetan-3-yl)pyrazole;5-iodo-1H-pyrazole has a molecular weight of 444.01 g/mol, XLogP of 2.07, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-1-(oxetan-3-yl)pyrazole;5-iodo-1H-pyrazole is sourced from PubChem (CID 158209715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).