C13H17N3O — CID 157041913
3-(2,5-dimethylpyrrol-1-yl)-1-[(3S)-oxolan-3-yl]pyrazole (PubChem CID 157041913) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is 3-(2,5-dimethylpyrrol-1-yl)-1-[(3S)-oxolan-3-yl]pyrazole.
| Compound Name | 3-(2,5-dimethylpyrrol-1-yl)-1-[(3S)-oxolan-3-yl]pyrazole |
|---|---|
| PubChem CID | 157041913 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 3-(2,5-dimethylpyrrol-1-yl)-1-[(3S)-oxolan-3-yl]pyrazole |
| SMILES | Cc1ccc(C)n1-c1ccn([C@H]2CCOC2)n1 |
| InChI | InChI=1S/C13H17N3O/c1-10-3-4-11(2)16(10)13-5-7-15(14-13)12-6-8-17-9-12/h3-5,7,12H,6,8-9H2,1-2H3/t12-/m0/s1 |
| InChIKey | YKMFAACJNZANGG-LBPRGKRZSA-N |
| XLogP | 2.25 |
| TPSA | 31.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_E(5)', 'substructure': 'N/A'} |
|---|