C21H20FN5O3 — CID 137092662
2-(6-fluoro-5-methoxy-3-pyridinyl)-4-methyl-6-[1-[(3S)-oxolan-3-yl]pyrazol-3-yl]pyrrolo[3,4-b]pyridin-5-ol (PubChem CID 137092662) has the molecular formula C21H20FN5O3 and a molecular weight of 409.42 g/mol. Its IUPAC name is 2-(6-fluoro-5-methoxy-3-pyridinyl)-4-methyl-6-[1-[(3S)-oxolan-3-yl]pyrazol-3-yl]pyrrolo[3,4-b]pyridin-5-ol.
| Compound Name | 2-(6-fluoro-5-methoxy-3-pyridinyl)-4-methyl-6-[1-[(3S)-oxolan-3-yl]pyrazol-3-yl]pyrrolo[3,4-b]pyridin-5-ol |
|---|---|
| PubChem CID | 137092662 |
| Molecular Formula | C21H20FN5O3 |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 2-(6-fluoro-5-methoxy-3-pyridinyl)-4-methyl-6-[1-[(3S)-oxolan-3-yl]pyrazol-3-yl]pyrrolo[3,4-b]pyridin-5-ol |
| SMILES | COc1cc(-c2cc(C)c3c(O)n(-c4ccn([C@H]5CCOC5)n4)cc3n2)cnc1F |
| InChI | InChI=1S/C21H20FN5O3/c1-12-7-15(13-8-17(29-2)20(22)23-9-13)24-16-10-26(21(28)19(12)16)18-3-5-27(25-18)14-4-6-30-11-14/h3,5,7-10,14,28H,4,6,11H2,1-2H3/t14-/m0/s1 |
| InChIKey | BQGSMAWWLGAXSD-AWEZNQCLSA-N |
| XLogP | 3.41 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|