C9H11F3N2O — CID 107137610
1-(oxan-3-yl)-3-(trifluoromethyl)pyrazole (PubChem CID 107137610) has the molecular formula C9H11F3N2O and a molecular weight of 220.19 g/mol. Its IUPAC name is 1-(oxan-3-yl)-3-(trifluoromethyl)pyrazole.
| Compound Name | 1-(oxan-3-yl)-3-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 107137610 |
| Molecular Formula | C9H11F3N2O |
| Molecular Weight | 220.19 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 1-(oxan-3-yl)-3-(trifluoromethyl)pyrazole |
| SMILES | FC(F)(F)c1ccn(C2CCCOC2)n1 |
| InChI | InChI=1S/C9H11F3N2O/c10-9(11,12)8-3-4-14(13-8)7-2-1-5-15-6-7/h3-4,7H,1-2,5-6H2 |
| InChIKey | IOWDVAWARJJMGP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.19 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |