C35H70 — CID 158213793
(Z)-2,2,4,7,7-pentamethyloct-4-ene;(E)-2,2,4,7,7-pentamethyloct-4-ene;2,5,5-trimethylhex-2-ene (PubChem CID 158213793) has the molecular formula C35H70 and a molecular weight of 490.95 g/mol. Its IUPAC name is (Z)-2,2,4,7,7-pentamethyloct-4-ene;(E)-2,2,4,7,7-pentamethyloct-4-ene;2,5,5-trimethylhex-2-ene.
| Compound Name | (Z)-2,2,4,7,7-pentamethyloct-4-ene;(E)-2,2,4,7,7-pentamethyloct-4-ene;2,5,5-trimethylhex-2-ene |
|---|---|
| PubChem CID | 158213793 |
| Molecular Formula | C35H70 |
| Molecular Weight | 490.95 g/mol |
| Exact Mass | 490.55 |
| IUPAC Name | (Z)-2,2,4,7,7-pentamethyloct-4-ene;(E)-2,2,4,7,7-pentamethyloct-4-ene;2,5,5-trimethylhex-2-ene |
| SMILES | C/C(=C/CC(C)(C)C)CC(C)(C)C.C/C(=C\CC(C)(C)C)CC(C)(C)C.CC(C)=CCC(C)(C)C |
| InChI | InChI=1S/2C13H26.C9H18/c2*1-11(10-13(5,6)7)8-9-12(2,3)4;1-8(2)6-7-9(3,4)5/h2*8H,9-10H2,1-7H3;6H,7H2,1-5H3/b11-8+;11-8-; |
| InChIKey | GCJVXRRGMRTCMR-JGCTZPGFSA-N |
| XLogP | 13.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.95 |
| LogP ≤ 5 | 13.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|