C18H34S — CID 88849763
(5E)-3,3,6,8,8,11-hexamethyldodeca-5,10-diene-1-thiol (PubChem CID 88849763) has the molecular formula C18H34S and a molecular weight of 282.54 g/mol. Its IUPAC name is (5E)-3,3,6,8,8,11-hexamethyldodeca-5,10-diene-1-thiol.
| Compound Name | (5E)-3,3,6,8,8,11-hexamethyldodeca-5,10-diene-1-thiol |
|---|---|
| PubChem CID | 88849763 |
| Molecular Formula | C18H34S |
| Molecular Weight | 282.54 g/mol |
| Exact Mass | 282.24 |
| IUPAC Name | (5E)-3,3,6,8,8,11-hexamethyldodeca-5,10-diene-1-thiol |
| SMILES | CC(C)=CCC(C)(C)C/C(C)=C/CC(C)(C)CCS |
| InChI | InChI=1S/C18H34S/c1-15(2)8-10-18(6,7)14-16(3)9-11-17(4,5)12-13-19/h8-9,19H,10-14H2,1-7H3/b16-9+ |
| InChIKey | PBZVBDZAEPNCID-CXUHLZMHSA-N |
| XLogP | 6.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.54 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|