C25H41F3O — CID 123995091
4,4,7,9,9,12,16-heptamethyl-3-(trifluoromethyl)heptadeca-6,11,15-trien-2-one (PubChem CID 123995091) has the molecular formula C25H41F3O and a molecular weight of 414.60 g/mol. Its IUPAC name is 4,4,7,9,9,12,16-heptamethyl-3-(trifluoromethyl)heptadeca-6,11,15-trien-2-one.
| Compound Name | 4,4,7,9,9,12,16-heptamethyl-3-(trifluoromethyl)heptadeca-6,11,15-trien-2-one |
|---|---|
| PubChem CID | 123995091 |
| Molecular Formula | C25H41F3O |
| Molecular Weight | 414.60 g/mol |
| Exact Mass | 414.31 |
| IUPAC Name | 4,4,7,9,9,12,16-heptamethyl-3-(trifluoromethyl)heptadeca-6,11,15-trien-2-one |
| SMILES | CC(=O)C(C(F)(F)F)C(C)(C)CC=C(C)CC(C)(C)CC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C25H41F3O/c1-18(2)11-10-12-19(3)13-15-23(6,7)17-20(4)14-16-24(8,9)22(21(5)29)25(26,27)28/h11,13-14,22H,10,12,15-17H2,1-9H3 |
| InChIKey | ZWCVYNPCRYILMM-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.60 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|