C21H28F3N3O2 — CID 158216691
5-[3-[4-[[butyl(methyl)amino]methyl]-1H-pyrazol-5-yl]-5-(trifluoromethyl)phenoxy]pentan-2-one (PubChem CID 158216691) has the molecular formula C21H28F3N3O2 and a molecular weight of 411.47 g/mol. Its IUPAC name is 5-[3-[4-[[butyl(methyl)amino]methyl]-1H-pyrazol-5-yl]-5-(trifluoromethyl)phenoxy]pentan-2-one.
| Compound Name | 5-[3-[4-[[butyl(methyl)amino]methyl]-1H-pyrazol-5-yl]-5-(trifluoromethyl)phenoxy]pentan-2-one |
|---|---|
| PubChem CID | 158216691 |
| Molecular Formula | C21H28F3N3O2 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 5-[3-[4-[[butyl(methyl)amino]methyl]-1H-pyrazol-5-yl]-5-(trifluoromethyl)phenoxy]pentan-2-one |
| SMILES | CCCCN(C)Cc1cn[nH]c1-c1cc(OCCCC(C)=O)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H28F3N3O2/c1-4-5-8-27(3)14-17-13-25-26-20(17)16-10-18(21(22,23)24)12-19(11-16)29-9-6-7-15(2)28/h10-13H,4-9,14H2,1-3H3,(H,25,26) |
| InChIKey | PYCRNRVRQSRJNY-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|