C24H28F3N3O2 — CID 158645742
N-methyl-N-[[5-[4-[2-[4-(trifluoromethyl)phenoxy]ethoxy]phenyl]-1H-pyrazol-4-yl]methyl]butan-1-amine (PubChem CID 158645742) has the molecular formula C24H28F3N3O2 and a molecular weight of 447.50 g/mol. Its IUPAC name is N-methyl-N-[[5-[4-[2-[4-(trifluoromethyl)phenoxy]ethoxy]phenyl]-1H-pyrazol-4-yl]methyl]butan-1-amine.
| Compound Name | N-methyl-N-[[5-[4-[2-[4-(trifluoromethyl)phenoxy]ethoxy]phenyl]-1H-pyrazol-4-yl]methyl]butan-1-amine |
|---|---|
| PubChem CID | 158645742 |
| Molecular Formula | C24H28F3N3O2 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | N-methyl-N-[[5-[4-[2-[4-(trifluoromethyl)phenoxy]ethoxy]phenyl]-1H-pyrazol-4-yl]methyl]butan-1-amine |
| SMILES | CCCCN(C)Cc1cn[nH]c1-c1ccc(OCCOc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C24H28F3N3O2/c1-3-4-13-30(2)17-19-16-28-29-23(19)18-5-9-21(10-6-18)31-14-15-32-22-11-7-20(8-12-22)24(25,26)27/h5-12,16H,3-4,13-15,17H2,1-2H3,(H,28,29) |
| InChIKey | IAYDFOBWWZXDQQ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|