C15H22N4O — CID 158218730
3-(1,5-dimethyltriazol-4-yl)-N-phenylpropanamide;ethane (PubChem CID 158218730) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is 3-(1,5-dimethyltriazol-4-yl)-N-phenylpropanamide;ethane.
| Compound Name | 3-(1,5-dimethyltriazol-4-yl)-N-phenylpropanamide;ethane |
|---|---|
| PubChem CID | 158218730 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 3-(1,5-dimethyltriazol-4-yl)-N-phenylpropanamide;ethane |
| SMILES | CC.Cc1c(CCC(=O)Nc2ccccc2)nnn1C |
| InChI | InChI=1S/C13H16N4O.C2H6/c1-10-12(15-16-17(10)2)8-9-13(18)14-11-6-4-3-5-7-11;1-2/h3-7H,8-9H2,1-2H3,(H,14,18);1-2H3 |
| InChIKey | GCZFZGJEGDLOBS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |