C27H19F5N2O — CID 158224844
3-[4-fluoro-6-(4-fluorophenyl)indol-1-yl]-1-[4-isocyano-3-(trifluoromethyl)phenyl]-3-methylbutan-2-one (PubChem CID 158224844) has the molecular formula C27H19F5N2O and a molecular weight of 482.45 g/mol. Its IUPAC name is 3-[4-fluoro-6-(4-fluorophenyl)indol-1-yl]-1-[4-isocyano-3-(trifluoromethyl)phenyl]-3-methylbutan-2-one.
| Compound Name | 3-[4-fluoro-6-(4-fluorophenyl)indol-1-yl]-1-[4-isocyano-3-(trifluoromethyl)phenyl]-3-methylbutan-2-one |
|---|---|
| PubChem CID | 158224844 |
| Molecular Formula | C27H19F5N2O |
| Molecular Weight | 482.45 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 3-[4-fluoro-6-(4-fluorophenyl)indol-1-yl]-1-[4-isocyano-3-(trifluoromethyl)phenyl]-3-methylbutan-2-one |
| SMILES | [C-]#[N+]c1ccc(CC(=O)C(C)(C)n2ccc3c(F)cc(-c4ccc(F)cc4)cc32)cc1C(F)(F)F |
| InChI | InChI=1S/C27H19F5N2O/c1-26(2,25(35)13-16-4-9-23(33-3)21(12-16)27(30,31)32)34-11-10-20-22(29)14-18(15-24(20)34)17-5-7-19(28)8-6-17/h4-12,14-15H,13H2,1-2H3 |
| InChIKey | XDQSNJGFXLAITA-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 26.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.45 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|