C20H17NO — CID 134154232
(2E)-2-[(1-methylindol-5-yl)methylidene]-3,4-dihydronaphthalen-1-one (PubChem CID 134154232) has the molecular formula C20H17NO and a molecular weight of 287.36 g/mol. Its IUPAC name is (2E)-2-[(1-methylindol-5-yl)methylidene]-3,4-dihydronaphthalen-1-one.
| Compound Name | (2E)-2-[(1-methylindol-5-yl)methylidene]-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 134154232 |
| Molecular Formula | C20H17NO |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | (2E)-2-[(1-methylindol-5-yl)methylidene]-3,4-dihydronaphthalen-1-one |
| SMILES | Cn1ccc2cc(/C=C3\CCc4ccccc4C3=O)ccc21 |
| InChI | InChI=1S/C20H17NO/c1-21-11-10-16-12-14(6-9-19(16)21)13-17-8-7-15-4-2-3-5-18(15)20(17)22/h2-6,9-13H,7-8H2,1H3/b17-13+ |
| InChIKey | GCNWSHSTJJQQRT-GHRIWEEISA-N |
| XLogP | 4.39 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|