C21H19NO2 — CID 134154729
(2E)-7-methoxy-2-[(1-methylindol-5-yl)methylidene]-3,4-dihydronaphthalen-1-one (PubChem CID 134154729) has the molecular formula C21H19NO2 and a molecular weight of 317.39 g/mol. Its IUPAC name is (2E)-7-methoxy-2-[(1-methylindol-5-yl)methylidene]-3,4-dihydronaphthalen-1-one.
| Compound Name | (2E)-7-methoxy-2-[(1-methylindol-5-yl)methylidene]-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 134154729 |
| Molecular Formula | C21H19NO2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | (2E)-7-methoxy-2-[(1-methylindol-5-yl)methylidene]-3,4-dihydronaphthalen-1-one |
| SMILES | COc1ccc2c(c1)C(=O)/C(=C/c1ccc3c(ccn3C)c1)CC2 |
| InChI | InChI=1S/C21H19NO2/c1-22-10-9-16-11-14(3-8-20(16)22)12-17-5-4-15-6-7-18(24-2)13-19(15)21(17)23/h3,6-13H,4-5H2,1-2H3/b17-12+ |
| InChIKey | KSRKDRMDHCYHHD-SFQUDFHCSA-N |
| XLogP | 4.40 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|