C24H22FNO3 — CID 134152280
tert-butyl 5-[(E)-(7-fluoro-1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]indole-1-carboxylate (PubChem CID 134152280) has the molecular formula C24H22FNO3 and a molecular weight of 391.44 g/mol. Its IUPAC name is tert-butyl 5-[(E)-(7-fluoro-1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]indole-1-carboxylate.
| Compound Name | tert-butyl 5-[(E)-(7-fluoro-1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 134152280 |
| Molecular Formula | C24H22FNO3 |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | tert-butyl 5-[(E)-(7-fluoro-1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1ccc2cc(/C=C3\CCc4ccc(F)cc4C3=O)ccc21 |
| InChI | InChI=1S/C24H22FNO3/c1-24(2,3)29-23(28)26-11-10-17-12-15(4-9-21(17)26)13-18-6-5-16-7-8-19(25)14-20(16)22(18)27/h4,7-14H,5-6H2,1-3H3/b18-13+ |
| InChIKey | HGZBXVSCIKHKMK-QGOAFFKASA-N |
| XLogP | 5.78 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|