About 2-chloro-3-nitropyrazine;4-chloro-5-nitropyrimidine
2-chloro-3-nitropyrazine;4-chloro-5-nitropyrimidine (PubChem CID 158230025) has the molecular formula C8H4Cl2N6O4
and a molecular weight of 319.06 g/mol. Its IUPAC name is 2-chloro-3-nitropyrazine;4-chloro-5-nitropyrimidine.
Molecular Properties
| Compound Name | 2-chloro-3-nitropyrazine;4-chloro-5-nitropyrimidine |
| PubChem CID | 158230025 |
| Molecular Formula | C8H4Cl2N6O4 |
| Molecular Weight | 319.06 g/mol |
| Exact Mass | 317.97 |
| IUPAC Name | 2-chloro-3-nitropyrazine;4-chloro-5-nitropyrimidine |
| SMILES | O=[N+]([O-])c1cncnc1Cl.O=[N+]([O-])c1nccnc1Cl |
| InChI | InChI=1S/2C4H2ClN3O2/c5-4-3(8(9)10)1-6-2-7-4;5-3-4(8(9)10)7-2-1-6-3/h2*1-2H |
| InChIKey | GEGNZBXMQTWXAD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 137.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.06 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3-nitropyrazine;4-chloro-5-nitropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-nitropyrazine;4-chloro-5-nitropyrimidine?
The IUPAC name of 2-chloro-3-nitropyrazine;4-chloro-5-nitropyrimidine (CID 158230025) is 2-chloro-3-nitropyrazine;4-chloro-5-nitropyrimidine.
What is the SMILES notation for 2-chloro-3-nitropyrazine;4-chloro-5-nitropyrimidine?
The canonical SMILES for 2-chloro-3-nitropyrazine;4-chloro-5-nitropyrimidine is O=[N+]([O-])c1cncnc1Cl.O=[N+]([O-])c1nccnc1Cl.
What is the InChIKey of 2-chloro-3-nitropyrazine;4-chloro-5-nitropyrimidine?
The InChIKey is GEGNZBXMQTWXAD-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H2ClN3O2/c5-4-3(8(9)10)1-6-2-7-4;5-3-4(8(9)10)7-2-1-6-3/h2*1-2H.
What are the key properties of 2-chloro-3-nitropyrazine;4-chloro-5-nitropyrimidine?
2-chloro-3-nitropyrazine;4-chloro-5-nitropyrimidine has a molecular weight of 319.06 g/mol, XLogP of 2.08, 2 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-nitropyrazine;4-chloro-5-nitropyrimidine is sourced from PubChem (CID 158230025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).