About 1-(1-ethyl-6-methylindol-3-yl)ethanone;5-(1-ethyl-6-methylindol-3-yl)-1,2-oxazole
1-(1-ethyl-6-methylindol-3-yl)ethanone;5-(1-ethyl-6-methylindol-3-yl)-1,2-oxazole (PubChem CID 158233296) has the molecular formula C27H29N3O2
and a molecular weight of 427.55 g/mol. Its IUPAC name is 1-(1-ethyl-6-methylindol-3-yl)ethanone;5-(1-ethyl-6-methylindol-3-yl)-1,2-oxazole.
Molecular Properties
| Compound Name | 1-(1-ethyl-6-methylindol-3-yl)ethanone;5-(1-ethyl-6-methylindol-3-yl)-1,2-oxazole |
| PubChem CID | 158233296 |
| Molecular Formula | C27H29N3O2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | 1-(1-ethyl-6-methylindol-3-yl)ethanone;5-(1-ethyl-6-methylindol-3-yl)-1,2-oxazole |
| SMILES | CCn1cc(-c2ccno2)c2ccc(C)cc21.CCn1cc(C(C)=O)c2ccc(C)cc21 |
| InChI | InChI=1S/C14H14N2O.C13H15NO/c1-3-16-9-12(14-6-7-15-17-14)11-5-4-10(2)8-13(11)16;1-4-14-8-12(10(3)15)11-6-5-9(2)7-13(11)14/h4-9H,3H2,1-2H3;5-8H,4H2,1-3H3 |
| InChIKey | GEQKSLXXCFFTJN-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 52.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(1-ethyl-6-methylindol-3-yl)ethanone;5-(1-ethyl-6-methylindol-3-yl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-ethyl-6-methylindol-3-yl)ethanone;5-(1-ethyl-6-methylindol-3-yl)-1,2-oxazole?
The IUPAC name of 1-(1-ethyl-6-methylindol-3-yl)ethanone;5-(1-ethyl-6-methylindol-3-yl)-1,2-oxazole (CID 158233296) is 1-(1-ethyl-6-methylindol-3-yl)ethanone;5-(1-ethyl-6-methylindol-3-yl)-1,2-oxazole.
What is the SMILES notation for 1-(1-ethyl-6-methylindol-3-yl)ethanone;5-(1-ethyl-6-methylindol-3-yl)-1,2-oxazole?
The canonical SMILES for 1-(1-ethyl-6-methylindol-3-yl)ethanone;5-(1-ethyl-6-methylindol-3-yl)-1,2-oxazole is CCn1cc(-c2ccno2)c2ccc(C)cc21.CCn1cc(C(C)=O)c2ccc(C)cc21.
What is the InChIKey of 1-(1-ethyl-6-methylindol-3-yl)ethanone;5-(1-ethyl-6-methylindol-3-yl)-1,2-oxazole?
The InChIKey is GEQKSLXXCFFTJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O.C13H15NO/c1-3-16-9-12(14-6-7-15-17-14)11-5-4-10(2)8-13(11)16;1-4-14-8-12(10(3)15)11-6-5-9(2)7-13(11)14/h4-9H,3H2,1-2H3;5-8H,4H2,1-3H3.
What are the key properties of 1-(1-ethyl-6-methylindol-3-yl)ethanone;5-(1-ethyl-6-methylindol-3-yl)-1,2-oxazole?
1-(1-ethyl-6-methylindol-3-yl)ethanone;5-(1-ethyl-6-methylindol-3-yl)-1,2-oxazole has a molecular weight of 427.55 g/mol, XLogP of 6.80, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-ethyl-6-methylindol-3-yl)ethanone;5-(1-ethyl-6-methylindol-3-yl)-1,2-oxazole is sourced from PubChem (CID 158233296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).