C27H30Cl2O4S — CID 158234282
(17R)-17-[2-(2,4-dichlorophenyl)sulfanylacetyl]-11,17-dihydroxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 158234282) has the molecular formula C27H30Cl2O4S and a molecular weight of 521.51 g/mol. Its IUPAC name is (17R)-17-[2-(2,4-dichlorophenyl)sulfanylacetyl]-11,17-dihydroxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (17R)-17-[2-(2,4-dichlorophenyl)sulfanylacetyl]-11,17-dihydroxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 158234282 |
| Molecular Formula | C27H30Cl2O4S |
| Molecular Weight | 521.51 g/mol |
| Exact Mass | 520.12 |
| IUPAC Name | (17R)-17-[2-(2,4-dichlorophenyl)sulfanylacetyl]-11,17-dihydroxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC12C=CC(=O)C=C1CCC1C2C(O)CC2(C)C1CC[C@]2(O)C(=O)CSc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H30Cl2O4S/c1-25-9-7-17(30)11-15(25)3-5-18-19-8-10-27(33,26(19,2)13-21(31)24(18)25)23(32)14-34-22-6-4-16(28)12-20(22)29/h4,6-7,9,11-12,18-19,21,24,31,33H,3,5,8,10,13-14H2,1-2H3/t18?,19?,21?,24?,25?,26?,27-/m0/s1 |
| InChIKey | WIDNYVMJCRQSQX-YIPXTGCNSA-N |
| XLogP | 5.66 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.51 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |