C33H33Cl3FN5O4S — CID 158238142
4-[[(3S,4S,6S)-4-amino-7,7-dichloro-6-(3-methylphenyl)-3-bicyclo[4.1.0]heptanyl]amino]-5-chloro-N-[(2,4-dimethoxyphenyl)methyl]-2-fluoro-N-pyrimidin-4-ylbenzenesulfonamide (PubChem CID 158238142) has the molecular formula C33H33Cl3FN5O4S and a molecular weight of 721.08 g/mol. Its IUPAC name is 4-[[(3S,4S,6S)-4-amino-7,7-dichloro-6-(3-methylphenyl)-3-bicyclo[4.1.0]heptanyl]amino]-5-chloro-N-[(2,4-dimethoxyphenyl)methyl]-2-fluoro-N-pyrimidin-4-ylbenzenesulfonamide.
| Compound Name | 4-[[(3S,4S,6S)-4-amino-7,7-dichloro-6-(3-methylphenyl)-3-bicyclo[4.1.0]heptanyl]amino]-5-chloro-N-[(2,4-dimethoxyphenyl)methyl]-2-fluoro-N-pyrimidin-4-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 158238142 |
| Molecular Formula | C33H33Cl3FN5O4S |
| Molecular Weight | 721.08 g/mol |
| Exact Mass | 719.13 |
| IUPAC Name | 4-[[(3S,4S,6S)-4-amino-7,7-dichloro-6-(3-methylphenyl)-3-bicyclo[4.1.0]heptanyl]amino]-5-chloro-N-[(2,4-dimethoxyphenyl)methyl]-2-fluoro-N-pyrimidin-4-ylbenzenesulfonamide |
| SMILES | COc1ccc(CN(c2ccncn2)S(=O)(=O)c2cc(Cl)c(N[C@H]3CC4C(Cl)(Cl)[C@@]4(c4cccc(C)c4)C[C@@H]3N)cc2F)c(OC)c1 |
| InChI | InChI=1S/C33H33Cl3FN5O4S/c1-19-5-4-6-21(11-19)32-16-25(38)27(15-30(32)33(32,35)36)41-26-14-24(37)29(13-23(26)34)47(43,44)42(31-9-10-39-18-40-31)17-20-7-8-22(45-2)12-28(20)46-3/h4-14,18,25,27,30,41H,15-17,38H2,1-3H3/t25-,27-,30?,32+/m0/s1 |
| InChIKey | GFFKALJCZNGSFB-JKIZQNOPSA-N |
| XLogP | 6.63 |
| TPSA | 119.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.08 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|