C18H22N3O3P — CID 158241216
2-(1-nitrobutan-2-yl)-1,3-diphenyl-1,3,2λ5-diazaphospholidine 2-oxide (PubChem CID 158241216) has the molecular formula C18H22N3O3P and a molecular weight of 359.37 g/mol. Its IUPAC name is 2-(1-nitrobutan-2-yl)-1,3-diphenyl-1,3,2λ5-diazaphospholidine 2-oxide.
| Compound Name | 2-(1-nitrobutan-2-yl)-1,3-diphenyl-1,3,2λ5-diazaphospholidine 2-oxide |
|---|---|
| PubChem CID | 158241216 |
| Molecular Formula | C18H22N3O3P |
| Molecular Weight | 359.37 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 2-(1-nitrobutan-2-yl)-1,3-diphenyl-1,3,2λ5-diazaphospholidine 2-oxide |
| SMILES | CCC(C[N+](=O)[O-])P1(=O)N(c2ccccc2)CCN1c1ccccc1 |
| InChI | InChI=1S/C18H22N3O3P/c1-2-18(15-21(22)23)25(24)19(16-9-5-3-6-10-16)13-14-20(25)17-11-7-4-8-12-17/h3-12,18H,2,13-15H2,1H3 |
| InChIKey | KVCITXBXIZOAFT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.37 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|