C23H23FN3O3P — CID 134272261
2-[1-(2-fluorophenyl)-2-nitroethyl]-1,3-diphenyl-1,3,2λ5-diazaphosphinane 2-oxide (PubChem CID 134272261) has the molecular formula C23H23FN3O3P and a molecular weight of 439.43 g/mol. Its IUPAC name is 2-[1-(2-fluorophenyl)-2-nitroethyl]-1,3-diphenyl-1,3,2λ5-diazaphosphinane 2-oxide.
| Compound Name | 2-[1-(2-fluorophenyl)-2-nitroethyl]-1,3-diphenyl-1,3,2λ5-diazaphosphinane 2-oxide |
|---|---|
| PubChem CID | 134272261 |
| Molecular Formula | C23H23FN3O3P |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 2-[1-(2-fluorophenyl)-2-nitroethyl]-1,3-diphenyl-1,3,2λ5-diazaphosphinane 2-oxide |
| SMILES | O=[N+]([O-])CC(c1ccccc1F)P1(=O)N(c2ccccc2)CCCN1c1ccccc1 |
| InChI | InChI=1S/C23H23FN3O3P/c24-22-15-8-7-14-21(22)23(18-27(28)29)31(30)25(19-10-3-1-4-11-19)16-9-17-26(31)20-12-5-2-6-13-20/h1-8,10-15,23H,9,16-18H2 |
| InChIKey | VLAKUHAIZQRRFE-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|