C11H12FNO4S — CID 70169531
2-[1-(2-fluorophenyl)-2-nitroethyl]sulfanylpropanoic acid (PubChem CID 70169531) has the molecular formula C11H12FNO4S and a molecular weight of 273.28 g/mol. Its IUPAC name is 2-[1-(2-fluorophenyl)-2-nitroethyl]sulfanylpropanoic acid.
| Compound Name | 2-[1-(2-fluorophenyl)-2-nitroethyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 70169531 |
| Molecular Formula | C11H12FNO4S |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 2-[1-(2-fluorophenyl)-2-nitroethyl]sulfanylpropanoic acid |
| SMILES | CC(SC(C[N+](=O)[O-])c1ccccc1F)C(=O)O |
| InChI | InChI=1S/C11H12FNO4S/c1-7(11(14)15)18-10(6-13(16)17)8-4-2-3-5-9(8)12/h2-5,7,10H,6H2,1H3,(H,14,15) |
| InChIKey | IPAZUNBUDOCBRL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|