C25H22F3N9O4 — CID 158242210
1-ethyl-3-fluoroindazol-5-amine;1-ethyl-3-fluoro-5-nitroindazole;3-fluoro-5-nitro-2H-indazole (PubChem CID 158242210) has the molecular formula C25H22F3N9O4 and a molecular weight of 569.50 g/mol. Its IUPAC name is 1-ethyl-3-fluoroindazol-5-amine;1-ethyl-3-fluoro-5-nitroindazole;3-fluoro-5-nitro-2H-indazole.
| Compound Name | 1-ethyl-3-fluoroindazol-5-amine;1-ethyl-3-fluoro-5-nitroindazole;3-fluoro-5-nitro-2H-indazole |
|---|---|
| PubChem CID | 158242210 |
| Molecular Formula | C25H22F3N9O4 |
| Molecular Weight | 569.50 g/mol |
| Exact Mass | 569.17 |
| IUPAC Name | 1-ethyl-3-fluoroindazol-5-amine;1-ethyl-3-fluoro-5-nitroindazole;3-fluoro-5-nitro-2H-indazole |
| SMILES | CCn1nc(F)c2cc(N)ccc21.CCn1nc(F)c2cc([N+](=O)[O-])ccc21.O=[N+]([O-])c1ccc2n[nH]c(F)c2c1 |
| InChI | InChI=1S/C9H8FN3O2.C9H10FN3.C7H4FN3O2/c1-2-12-8-4-3-6(13(14)15)5-7(8)9(10)11-12;1-2-13-8-4-3-6(11)5-7(8)9(10)12-13;8-7-5-3-4(11(12)13)1-2-6(5)9-10-7/h3-5H,2H2,1H3;3-5H,2,11H2,1H3;1-3H,(H,9,10) |
| InChIKey | GFRJHYHVYQOYMH-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 176.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.50 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|