C24H15F9N8O2 — CID 158978603
5-nitro-6-(trifluoromethyl)-1H-indazole;6-(trifluoromethyl)-1H-indazol-5-amine;6-(trifluoromethyl)-1H-indazole (PubChem CID 158978603) has the molecular formula C24H15F9N8O2 and a molecular weight of 618.42 g/mol. Its IUPAC name is 5-nitro-6-(trifluoromethyl)-1H-indazole;6-(trifluoromethyl)-1H-indazol-5-amine;6-(trifluoromethyl)-1H-indazole.
| Compound Name | 5-nitro-6-(trifluoromethyl)-1H-indazole;6-(trifluoromethyl)-1H-indazol-5-amine;6-(trifluoromethyl)-1H-indazole |
|---|---|
| PubChem CID | 158978603 |
| Molecular Formula | C24H15F9N8O2 |
| Molecular Weight | 618.42 g/mol |
| Exact Mass | 618.12 |
| IUPAC Name | 5-nitro-6-(trifluoromethyl)-1H-indazole;6-(trifluoromethyl)-1H-indazol-5-amine;6-(trifluoromethyl)-1H-indazole |
| SMILES | FC(F)(F)c1ccc2cn[nH]c2c1.Nc1cc2cn[nH]c2cc1C(F)(F)F.O=[N+]([O-])c1cc2cn[nH]c2cc1C(F)(F)F |
| InChI | InChI=1S/C8H4F3N3O2.C8H6F3N3.C8H5F3N2/c9-8(10,11)5-2-6-4(3-12-13-6)1-7(5)14(15)16;9-8(10,11)5-2-7-4(1-6(5)12)3-13-14-7;9-8(10,11)6-2-1-5-4-12-13-7(5)3-6/h1-3H,(H,12,13);1-3H,12H2,(H,13,14);1-4H,(H,12,13) |
| InChIKey | JORYOXIRAOSPPV-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 155.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.42 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|