About 5-methyl-2H-benzotriazole;5-nitro-1H-indazole
5-methyl-2H-benzotriazole;5-nitro-1H-indazole (PubChem CID 67856400) has the molecular formula C14H12N6O2
and a molecular weight of 296.29 g/mol. Its IUPAC name is 5-methyl-2H-benzotriazole;5-nitro-1H-indazole.
Molecular Properties
| Compound Name | 5-methyl-2H-benzotriazole;5-nitro-1H-indazole |
| PubChem CID | 67856400 |
| Molecular Formula | C14H12N6O2 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 5-methyl-2H-benzotriazole;5-nitro-1H-indazole |
| SMILES | Cc1ccc2n[nH]nc2c1.O=[N+]([O-])c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C7H5N3O2.C7H7N3/c11-10(12)6-1-2-7-5(3-6)4-8-9-7;1-5-2-3-6-7(4-5)9-10-8-6/h1-4H,(H,8,9);2-4H,1H3,(H,8,9,10) |
| InChIKey | YYDHKTLLOGXXIH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-2H-benzotriazole;5-nitro-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2H-benzotriazole;5-nitro-1H-indazole?
The IUPAC name of 5-methyl-2H-benzotriazole;5-nitro-1H-indazole (CID 67856400) is 5-methyl-2H-benzotriazole;5-nitro-1H-indazole.
What is the SMILES notation for 5-methyl-2H-benzotriazole;5-nitro-1H-indazole?
The canonical SMILES for 5-methyl-2H-benzotriazole;5-nitro-1H-indazole is Cc1ccc2n[nH]nc2c1.O=[N+]([O-])c1ccc2[nH]ncc2c1.
What is the InChIKey of 5-methyl-2H-benzotriazole;5-nitro-1H-indazole?
The InChIKey is YYDHKTLLOGXXIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O2.C7H7N3/c11-10(12)6-1-2-7-5(3-6)4-8-9-7;1-5-2-3-6-7(4-5)9-10-8-6/h1-4H,(H,8,9);2-4H,1H3,(H,8,9,10).
What are the key properties of 5-methyl-2H-benzotriazole;5-nitro-1H-indazole?
5-methyl-2H-benzotriazole;5-nitro-1H-indazole has a molecular weight of 296.29 g/mol, XLogP of 2.74, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2H-benzotriazole;5-nitro-1H-indazole is sourced from PubChem (CID 67856400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).