About 2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]phenol
2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]phenol (PubChem CID 158242760) has the molecular formula C28H16F6N2O2S2
and a molecular weight of 590.57 g/mol. Its IUPAC name is 2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]phenol.
Molecular Properties
| Compound Name | 2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]phenol |
| PubChem CID | 158242760 |
| Molecular Formula | C28H16F6N2O2S2 |
| Molecular Weight | 590.57 g/mol |
| Exact Mass | 590.06 |
| IUPAC Name | 2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]phenol |
| SMILES | Oc1ccccc1-c1nc2cc(C(F)(F)F)ccc2s1.Oc1ccccc1-c1nc2cc(C(F)(F)F)ccc2s1 |
| InChI | InChI=1S/2C14H8F3NOS/c2*15-14(16,17)8-5-6-12-10(7-8)18-13(20-12)9-3-1-2-4-11(9)19/h2*1-7,19H |
| InChIKey | GFSZPZIYNAHTMM-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 590.57 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]phenol?
The IUPAC name of 2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]phenol (CID 158242760) is 2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]phenol.
What is the SMILES notation for 2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]phenol?
The canonical SMILES for 2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]phenol is Oc1ccccc1-c1nc2cc(C(F)(F)F)ccc2s1.Oc1ccccc1-c1nc2cc(C(F)(F)F)ccc2s1.
What is the InChIKey of 2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]phenol?
The InChIKey is GFSZPZIYNAHTMM-UHFFFAOYSA-N. The full InChI is InChI=1S/2C14H8F3NOS/c2*15-14(16,17)8-5-6-12-10(7-8)18-13(20-12)9-3-1-2-4-11(9)19/h2*1-7,19H.
What are the key properties of 2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]phenol?
2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]phenol has a molecular weight of 590.57 g/mol, XLogP of 9.38, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]phenol is sourced from PubChem (CID 158242760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).