About 1-(3-bromophenyl)-2-(1-methyl-2H-pyridin-2-yl)ethanone;iodic acid
1-(3-bromophenyl)-2-(1-methyl-2H-pyridin-2-yl)ethanone;iodic acid (PubChem CID 158243984) has the molecular formula C14H15BrINO4
and a molecular weight of 468.09 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2-(1-methyl-2H-pyridin-2-yl)ethanone;iodic acid.
Molecular Properties
| Compound Name | 1-(3-bromophenyl)-2-(1-methyl-2H-pyridin-2-yl)ethanone;iodic acid |
| PubChem CID | 158243984 |
| Molecular Formula | C14H15BrINO4 |
| Molecular Weight | 468.09 g/mol |
| Exact Mass | 466.92 |
| IUPAC Name | 1-(3-bromophenyl)-2-(1-methyl-2H-pyridin-2-yl)ethanone;iodic acid |
| SMILES | CN1C=CC=CC1CC(=O)c1cccc(Br)c1.[O-][I+2]([O-])O |
| InChI | InChI=1S/C14H14BrNO.HIO3/c1-16-8-3-2-7-13(16)10-14(17)11-5-4-6-12(15)9-11;2-1(3)4/h2-9,13H,10H2,1H3;2H |
| InChIKey | GFWZCKVPGGTCLW-UHFFFAOYSA-N |
| XLogP | -2.53 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 468.09 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-bromophenyl)-2-(1-methyl-2H-pyridin-2-yl)ethanone;iodic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-bromophenyl)-2-(1-methyl-2H-pyridin-2-yl)ethanone;iodic acid?
The IUPAC name of 1-(3-bromophenyl)-2-(1-methyl-2H-pyridin-2-yl)ethanone;iodic acid (CID 158243984) is 1-(3-bromophenyl)-2-(1-methyl-2H-pyridin-2-yl)ethanone;iodic acid.
What is the SMILES notation for 1-(3-bromophenyl)-2-(1-methyl-2H-pyridin-2-yl)ethanone;iodic acid?
The canonical SMILES for 1-(3-bromophenyl)-2-(1-methyl-2H-pyridin-2-yl)ethanone;iodic acid is CN1C=CC=CC1CC(=O)c1cccc(Br)c1.[O-][I+2]([O-])O.
What is the InChIKey of 1-(3-bromophenyl)-2-(1-methyl-2H-pyridin-2-yl)ethanone;iodic acid?
The InChIKey is GFWZCKVPGGTCLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14BrNO.HIO3/c1-16-8-3-2-7-13(16)10-14(17)11-5-4-6-12(15)9-11;2-1(3)4/h2-9,13H,10H2,1H3;2H.
What are the key properties of 1-(3-bromophenyl)-2-(1-methyl-2H-pyridin-2-yl)ethanone;iodic acid?
1-(3-bromophenyl)-2-(1-methyl-2H-pyridin-2-yl)ethanone;iodic acid has a molecular weight of 468.09 g/mol, XLogP of -2.53, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-bromophenyl)-2-(1-methyl-2H-pyridin-2-yl)ethanone;iodic acid is sourced from PubChem (CID 158243984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).