C29H25FN6O3 — CID 158246014
4-[10-[(1R,4R)-2,5-diazabicyclo[2.2.1]heptane-2-carbonyl]-6-fluoro-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]-5-imidazo[1,2-a]pyridin-3-ylcyclopent-4-ene-1,3-dione (PubChem CID 158246014) has the molecular formula C29H25FN6O3 and a molecular weight of 524.56 g/mol. Its IUPAC name is 4-[10-[(1R,4R)-2,5-diazabicyclo[2.2.1]heptane-2-carbonyl]-6-fluoro-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]-5-imidazo[1,2-a]pyridin-3-ylcyclopent-4-ene-1,3-dione.
| Compound Name | 4-[10-[(1R,4R)-2,5-diazabicyclo[2.2.1]heptane-2-carbonyl]-6-fluoro-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]-5-imidazo[1,2-a]pyridin-3-ylcyclopent-4-ene-1,3-dione |
|---|---|
| PubChem CID | 158246014 |
| Molecular Formula | C29H25FN6O3 |
| Molecular Weight | 524.56 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | 4-[10-[(1R,4R)-2,5-diazabicyclo[2.2.1]heptane-2-carbonyl]-6-fluoro-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]-5-imidazo[1,2-a]pyridin-3-ylcyclopent-4-ene-1,3-dione |
| SMILES | O=C1CC(=O)C(c2cnc3ccccn23)=C1c1cn2c3c(cc(F)cc13)CN(C(=O)N1C[C@H]3C[C@@H]1CN3)CC2 |
| InChI | InChI=1S/C29H25FN6O3/c30-17-7-16-13-34(29(39)36-14-18-9-19(36)11-31-18)6-5-33-15-21(20(8-17)28(16)33)26-23(37)10-24(38)27(26)22-12-32-25-3-1-2-4-35(22)25/h1-4,7-8,12,15,18-19,31H,5-6,9-11,13-14H2/t18-,19-/m1/s1 |
| InChIKey | CPNVFPNGMVYHNA-RTBURBONSA-N |
| XLogP | 2.86 |
| TPSA | 91.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.56 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|