C27H20N4O3 — CID 158475489
4-(10-acetyl-6-ethynyl-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl)-5-imidazo[1,2-a]pyridin-3-ylcyclopent-4-ene-1,3-dione (PubChem CID 158475489) has the molecular formula C27H20N4O3 and a molecular weight of 448.48 g/mol. Its IUPAC name is 4-(10-acetyl-6-ethynyl-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl)-5-imidazo[1,2-a]pyridin-3-ylcyclopent-4-ene-1,3-dione.
| Compound Name | 4-(10-acetyl-6-ethynyl-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl)-5-imidazo[1,2-a]pyridin-3-ylcyclopent-4-ene-1,3-dione |
|---|---|
| PubChem CID | 158475489 |
| Molecular Formula | C27H20N4O3 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 4-(10-acetyl-6-ethynyl-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl)-5-imidazo[1,2-a]pyridin-3-ylcyclopent-4-ene-1,3-dione |
| SMILES | C#Cc1cc2c3c(c1)c(C1=C(c4cnc5ccccn45)C(=O)CC1=O)cn3CCN(C(C)=O)C2 |
| InChI | InChI=1S/C27H20N4O3/c1-3-17-10-18-14-29(16(2)32)8-9-30-15-20(19(11-17)27(18)30)25-22(33)12-23(34)26(25)21-13-28-24-6-4-5-7-31(21)24/h1,4-7,10-11,13,15H,8-9,12,14H2,2H3 |
| InChIKey | HGWMEHGQCIHZNO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 76.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|