C44H46N6O5+2 — CID 158246996
[4-(pyridin-1-ium-1-ylmethyl)phenyl]-[4-[2-[2-[2-[2-[4-[[4-(pyridin-1-ium-1-ylmethyl)phenyl]diazenyl]phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]phenyl]diazene (PubChem CID 158246996) has the molecular formula C44H46N6O5+2 and a molecular weight of 738.89 g/mol. Its IUPAC name is [4-(pyridin-1-ium-1-ylmethyl)phenyl]-[4-[2-[2-[2-[2-[4-[[4-(pyridin-1-ium-1-ylmethyl)phenyl]diazenyl]phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]phenyl]diazene.
| Compound Name | [4-(pyridin-1-ium-1-ylmethyl)phenyl]-[4-[2-[2-[2-[2-[4-[[4-(pyridin-1-ium-1-ylmethyl)phenyl]diazenyl]phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]phenyl]diazene |
|---|---|
| PubChem CID | 158246996 |
| Molecular Formula | C44H46N6O5+2 |
| Molecular Weight | 738.89 g/mol |
| Exact Mass | 738.35 |
| IUPAC Name | [4-(pyridin-1-ium-1-ylmethyl)phenyl]-[4-[2-[2-[2-[2-[4-[[4-(pyridin-1-ium-1-ylmethyl)phenyl]diazenyl]phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]phenyl]diazene |
| SMILES | c1cc[n+](Cc2ccc(/N=N/c3ccc(OCCOCCOCCOCCOc4ccc(/N=N/c5ccc(C[n+]6ccccc6)cc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C44H46N6O5/c1-3-23-49(24-4-1)35-37-7-11-39(12-8-37)45-47-41-15-19-43(20-16-41)54-33-31-52-29-27-51-28-30-53-32-34-55-44-21-17-42(18-22-44)48-46-40-13-9-38(10-14-40)36-50-25-5-2-6-26-50/h1-26H,27-36H2/q+2/b47-45+,48-46+ |
| InChIKey | ZOUWNKJCERILOD-MLGMXDONSA-N |
| XLogP | 8.70 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.89 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|