C36H34FNO4S — CID 158248297
1-[1-[2-[3-fluoro-4-[2-(5-pentylfuran-2-yl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]acetyl]cyclopropyl]-2-(4-methylphenyl)ethanone (PubChem CID 158248297) has the molecular formula C36H34FNO4S and a molecular weight of 595.74 g/mol. Its IUPAC name is 1-[1-[2-[3-fluoro-4-[2-(5-pentylfuran-2-yl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]acetyl]cyclopropyl]-2-(4-methylphenyl)ethanone.
| Compound Name | 1-[1-[2-[3-fluoro-4-[2-(5-pentylfuran-2-yl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]acetyl]cyclopropyl]-2-(4-methylphenyl)ethanone |
|---|---|
| PubChem CID | 158248297 |
| Molecular Formula | C36H34FNO4S |
| Molecular Weight | 595.74 g/mol |
| Exact Mass | 595.22 |
| IUPAC Name | 1-[1-[2-[3-fluoro-4-[2-(5-pentylfuran-2-yl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]acetyl]cyclopropyl]-2-(4-methylphenyl)ethanone |
| SMILES | CCCCCc1ccc(-c2cc3nccc(Oc4ccc(CC(=O)C5(C(=O)Cc6ccc(C)cc6)CC5)cc4F)c3s2)o1 |
| InChI | InChI=1S/C36H34FNO4S/c1-3-4-5-6-26-12-14-30(41-26)32-22-28-35(43-32)31(15-18-38-28)42-29-13-11-25(19-27(29)37)21-34(40)36(16-17-36)33(39)20-24-9-7-23(2)8-10-24/h7-15,18-19,22H,3-6,16-17,20-21H2,1-2H3 |
| InChIKey | YZQDOPGUWCDRFJ-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.74 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|