About N,N-diethylpropanethioamide;methane;methyl propanoate
N,N-diethylpropanethioamide;methane;methyl propanoate (PubChem CID 158248779) has the molecular formula C14H35NO2S
and a molecular weight of 281.51 g/mol. Its IUPAC name is N,N-diethylpropanethioamide;methane;methyl propanoate.
Molecular Properties
| Compound Name | N,N-diethylpropanethioamide;methane;methyl propanoate |
| PubChem CID | 158248779 |
| Molecular Formula | C14H35NO2S |
| Molecular Weight | 281.51 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | N,N-diethylpropanethioamide;methane;methyl propanoate |
| SMILES | C.C.C.CCC(=O)OC.CCC(=S)N(CC)CC |
| InChI | InChI=1S/C7H15NS.C4H8O2.3CH4/c1-4-7(9)8(5-2)6-3;1-3-4(5)6-2;;;/h4-6H2,1-3H3;3H2,1-2H3;3*1H4 |
| InChIKey | GGLJTRMCHCXMSZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.51 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethylpropanethioamide;methane;methyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylpropanethioamide;methane;methyl propanoate?
The IUPAC name of N,N-diethylpropanethioamide;methane;methyl propanoate (CID 158248779) is N,N-diethylpropanethioamide;methane;methyl propanoate.
What is the SMILES notation for N,N-diethylpropanethioamide;methane;methyl propanoate?
The canonical SMILES for N,N-diethylpropanethioamide;methane;methyl propanoate is C.C.C.CCC(=O)OC.CCC(=S)N(CC)CC.
What is the InChIKey of N,N-diethylpropanethioamide;methane;methyl propanoate?
The InChIKey is GGLJTRMCHCXMSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NS.C4H8O2.3CH4/c1-4-7(9)8(5-2)6-3;1-3-4(5)6-2;;;/h4-6H2,1-3H3;3H2,1-2H3;3*1H4.
What are the key properties of N,N-diethylpropanethioamide;methane;methyl propanoate?
N,N-diethylpropanethioamide;methane;methyl propanoate has a molecular weight of 281.51 g/mol, XLogP of 4.54, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylpropanethioamide;methane;methyl propanoate is sourced from PubChem (CID 158248779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).