C23H22N6O4 — CID 158249650
N-[(2R)-1-amino-3-(4-nitrophenyl)-1-oxopropan-2-yl]-2-pyridin-4-yl-1H-benzimidazole-4-carboxamide;methane (PubChem CID 158249650) has the molecular formula C23H22N6O4 and a molecular weight of 446.47 g/mol. Its IUPAC name is N-[(2R)-1-amino-3-(4-nitrophenyl)-1-oxopropan-2-yl]-2-pyridin-4-yl-1H-benzimidazole-4-carboxamide;methane.
| Compound Name | N-[(2R)-1-amino-3-(4-nitrophenyl)-1-oxopropan-2-yl]-2-pyridin-4-yl-1H-benzimidazole-4-carboxamide;methane |
|---|---|
| PubChem CID | 158249650 |
| Molecular Formula | C23H22N6O4 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | N-[(2R)-1-amino-3-(4-nitrophenyl)-1-oxopropan-2-yl]-2-pyridin-4-yl-1H-benzimidazole-4-carboxamide;methane |
| SMILES | C.NC(=O)[C@@H](Cc1ccc([N+](=O)[O-])cc1)NC(=O)c1cccc2[nH]c(-c3ccncc3)nc12 |
| InChI | InChI=1S/C22H18N6O4.CH4/c23-20(29)18(12-13-4-6-15(7-5-13)28(31)32)26-22(30)16-2-1-3-17-19(16)27-21(25-17)14-8-10-24-11-9-14;/h1-11,18H,12H2,(H2,23,29)(H,25,27)(H,26,30);1H4/t18-;/m1./s1 |
| InChIKey | GGOAZOQVXMCNHR-GMUIIQOCSA-N |
| XLogP | 3.00 |
| TPSA | 156.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|