C35H37NO8S — CID 158252818
2-acetamidopentanoate;[4-[2-oxo-2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethoxy]phenyl]-diphenylsulfanium (PubChem CID 158252818) has the molecular formula C35H37NO8S and a molecular weight of 631.75 g/mol. Its IUPAC name is 2-acetamidopentanoate;[4-[2-oxo-2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethoxy]phenyl]-diphenylsulfanium.
| Compound Name | 2-acetamidopentanoate;[4-[2-oxo-2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethoxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 158252818 |
| Molecular Formula | C35H37NO8S |
| Molecular Weight | 631.75 g/mol |
| Exact Mass | 631.22 |
| IUPAC Name | 2-acetamidopentanoate;[4-[2-oxo-2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethoxy]phenyl]-diphenylsulfanium |
| SMILES | CCCC(NC(C)=O)C(=O)[O-].O=C(COc1ccc([S+](c2ccccc2)c2ccccc2)cc1)OC1C2CC3C(=O)OC1C3C2 |
| InChI | InChI=1S/C28H25O5S.C7H13NO3/c29-25(32-26-18-15-23-24(16-18)28(30)33-27(23)26)17-31-19-11-13-22(14-12-19)34(20-7-3-1-4-8-20)21-9-5-2-6-10-21;1-3-4-6(7(10)11)8-5(2)9/h1-14,18,23-24,26-27H,15-17H2;6H,3-4H2,1-2H3,(H,8,9)(H,10,11)/q+1;/p-1 |
| InChIKey | GGXPHIJHJPGZPB-UHFFFAOYSA-M |
| XLogP | 3.70 |
| TPSA | 131.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.75 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|