C64H120O16 — CID 158255362
(2-propan-2-yl-1,3-dioxan-5-yl) decanoate;(2-propan-2-yl-1,3-dioxan-5-yl) octanoate;(2-propyl-1,3-dioxan-5-yl) decanoate;(2-propyl-1,3-dioxan-5-yl) octanoate (PubChem CID 158255362) has the molecular formula C64H120O16 and a molecular weight of 1145.65 g/mol. Its IUPAC name is (2-propan-2-yl-1,3-dioxan-5-yl) decanoate;(2-propan-2-yl-1,3-dioxan-5-yl) octanoate;(2-propyl-1,3-dioxan-5-yl) decanoate;(2-propyl-1,3-dioxan-5-yl) octanoate.
| Compound Name | (2-propan-2-yl-1,3-dioxan-5-yl) decanoate;(2-propan-2-yl-1,3-dioxan-5-yl) octanoate;(2-propyl-1,3-dioxan-5-yl) decanoate;(2-propyl-1,3-dioxan-5-yl) octanoate |
|---|---|
| PubChem CID | 158255362 |
| Molecular Formula | C64H120O16 |
| Molecular Weight | 1145.65 g/mol |
| Exact Mass | 1144.86 |
| IUPAC Name | (2-propan-2-yl-1,3-dioxan-5-yl) decanoate;(2-propan-2-yl-1,3-dioxan-5-yl) octanoate;(2-propyl-1,3-dioxan-5-yl) decanoate;(2-propyl-1,3-dioxan-5-yl) octanoate |
| SMILES | CCCCCCCC(=O)OC1COC(C(C)C)OC1.CCCCCCCC(=O)OC1COC(CCC)OC1.CCCCCCCCCC(=O)OC1COC(C(C)C)OC1.CCCCCCCCCC(=O)OC1COC(CCC)OC1 |
| InChI | InChI=1S/2C17H32O4.2C15H28O4/c1-4-5-6-7-8-9-10-11-16(18)21-15-12-19-17(14(2)3)20-13-15;1-3-5-6-7-8-9-10-12-16(18)21-15-13-19-17(11-4-2)20-14-15;1-4-5-6-7-8-9-14(16)19-13-10-17-15(12(2)3)18-11-13;1-3-5-6-7-8-10-14(16)19-13-11-17-15(9-4-2)18-12-13/h14-15,17H,4-13H2,1-3H3;15,17H,3-14H2,1-2H3;12-13,15H,4-11H2,1-3H3;13,15H,3-12H2,1-2H3 |
| InChIKey | GHFIFFPJGPGBMA-UHFFFAOYSA-N |
| XLogP | 15.00 |
| TPSA | 179.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 80 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1145.65 |
| LogP ≤ 5 | 15.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|