C36H60O16 — CID 160585639
bis(2-propan-2-yl-1,3-dioxan-5-yl) butanedioate;bis(2-propyl-1,3-dioxan-5-yl) butanedioate (PubChem CID 160585639) has the molecular formula C36H60O16 and a molecular weight of 748.86 g/mol. Its IUPAC name is bis(2-propan-2-yl-1,3-dioxan-5-yl) butanedioate;bis(2-propyl-1,3-dioxan-5-yl) butanedioate.
| Compound Name | bis(2-propan-2-yl-1,3-dioxan-5-yl) butanedioate;bis(2-propyl-1,3-dioxan-5-yl) butanedioate |
|---|---|
| PubChem CID | 160585639 |
| Molecular Formula | C36H60O16 |
| Molecular Weight | 748.86 g/mol |
| Exact Mass | 748.39 |
| IUPAC Name | bis(2-propan-2-yl-1,3-dioxan-5-yl) butanedioate;bis(2-propyl-1,3-dioxan-5-yl) butanedioate |
| SMILES | CC(C)C1OCC(OC(=O)CCC(=O)OC2COC(C(C)C)OC2)CO1.CCCC1OCC(OC(=O)CCC(=O)OC2COC(CCC)OC2)CO1 |
| InChI | InChI=1S/2C18H30O8/c1-11(2)17-21-7-13(8-22-17)25-15(19)5-6-16(20)26-14-9-23-18(12(3)4)24-10-14;1-3-5-17-21-9-13(10-22-17)25-15(19)7-8-16(20)26-14-11-23-18(6-4-2)24-12-14/h11-14,17-18H,5-10H2,1-4H3;13-14,17-18H,3-12H2,1-2H3 |
| InChIKey | RCIVTHPVRJGDOA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 179.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.86 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|