About oxathiolan-4-yl butanoate
oxathiolan-4-yl butanoate (PubChem CID 139556489) has the molecular formula C7H12O3S
and a molecular weight of 176.24 g/mol. Its IUPAC name is oxathiolan-4-yl butanoate.
Molecular Properties
| Compound Name | oxathiolan-4-yl butanoate |
| PubChem CID | 139556489 |
| Molecular Formula | C7H12O3S |
| Molecular Weight | 176.24 g/mol |
| Exact Mass | 176.05 |
| IUPAC Name | oxathiolan-4-yl butanoate |
| SMILES | CCCC(=O)OC1COSC1 |
| InChI | InChI=1S/C7H12O3S/c1-2-3-7(8)10-6-4-9-11-5-6/h6H,2-5H2,1H3 |
| InChIKey | QKMCKIVHCCDOEO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.24 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze oxathiolan-4-yl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxathiolan-4-yl butanoate?
The IUPAC name of oxathiolan-4-yl butanoate (CID 139556489) is oxathiolan-4-yl butanoate.
What is the SMILES notation for oxathiolan-4-yl butanoate?
The canonical SMILES for oxathiolan-4-yl butanoate is CCCC(=O)OC1COSC1.
What is the InChIKey of oxathiolan-4-yl butanoate?
The InChIKey is QKMCKIVHCCDOEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3S/c1-2-3-7(8)10-6-4-9-11-5-6/h6H,2-5H2,1H3.
What are the key properties of oxathiolan-4-yl butanoate?
oxathiolan-4-yl butanoate has a molecular weight of 176.24 g/mol, XLogP of 1.38, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxathiolan-4-yl butanoate is sourced from PubChem (CID 139556489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).