C38H40N8O3 — CID 158255464
2-N,2-N-bis(pyridin-2-ylmethyl)benzene-1,2-diamine;ethanol;2-nitro-N,N-bis(pyridin-2-ylmethyl)aniline (PubChem CID 158255464) has the molecular formula C38H40N8O3 and a molecular weight of 656.79 g/mol. Its IUPAC name is 2-N,2-N-bis(pyridin-2-ylmethyl)benzene-1,2-diamine;ethanol;2-nitro-N,N-bis(pyridin-2-ylmethyl)aniline.
| Compound Name | 2-N,2-N-bis(pyridin-2-ylmethyl)benzene-1,2-diamine;ethanol;2-nitro-N,N-bis(pyridin-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 158255464 |
| Molecular Formula | C38H40N8O3 |
| Molecular Weight | 656.79 g/mol |
| Exact Mass | 656.32 |
| IUPAC Name | 2-N,2-N-bis(pyridin-2-ylmethyl)benzene-1,2-diamine;ethanol;2-nitro-N,N-bis(pyridin-2-ylmethyl)aniline |
| SMILES | CCO.Nc1ccccc1N(Cc1ccccn1)Cc1ccccn1.O=[N+]([O-])c1ccccc1N(Cc1ccccn1)Cc1ccccn1 |
| InChI | InChI=1S/C18H16N4O2.C18H18N4.C2H6O/c23-22(24)18-10-2-1-9-17(18)21(13-15-7-3-5-11-19-15)14-16-8-4-6-12-20-16;19-17-9-1-2-10-18(17)22(13-15-7-3-5-11-20-15)14-16-8-4-6-12-21-16;1-2-3/h1-12H,13-14H2;1-12H,13-14,19H2;3H,2H2,1H3 |
| InChIKey | GHFPUTIJIMFALW-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.79 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|