C24H30F4N4O2 — CID 158256021
1-(5,5-difluoro-1,4,6,7-tetrahydroindol-2-yl)ethanone;(5,5-difluoro-1,4,6,7-tetrahydroindol-2-yl)-(4-methylpiperazin-1-yl)methanone (PubChem CID 158256021) has the molecular formula C24H30F4N4O2 and a molecular weight of 482.52 g/mol. Its IUPAC name is 1-(5,5-difluoro-1,4,6,7-tetrahydroindol-2-yl)ethanone;(5,5-difluoro-1,4,6,7-tetrahydroindol-2-yl)-(4-methylpiperazin-1-yl)methanone.
| Compound Name | 1-(5,5-difluoro-1,4,6,7-tetrahydroindol-2-yl)ethanone;(5,5-difluoro-1,4,6,7-tetrahydroindol-2-yl)-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 158256021 |
| Molecular Formula | C24H30F4N4O2 |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | 1-(5,5-difluoro-1,4,6,7-tetrahydroindol-2-yl)ethanone;(5,5-difluoro-1,4,6,7-tetrahydroindol-2-yl)-(4-methylpiperazin-1-yl)methanone |
| SMILES | CC(=O)c1cc2c([nH]1)CCC(F)(F)C2.CN1CCN(C(=O)c2cc3c([nH]2)CCC(F)(F)C3)CC1 |
| InChI | InChI=1S/C14H19F2N3O.C10H11F2NO/c1-18-4-6-19(7-5-18)13(20)12-8-10-9-14(15,16)3-2-11(10)17-12;1-6(14)9-4-7-5-10(11,12)3-2-8(7)13-9/h8,17H,2-7,9H2,1H3;4,13H,2-3,5H2,1H3 |
| InChIKey | GHHHXEAMWMHLMM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |