About N-[3-(hydroxy-methylidene-oxo-λ6-sulfanyl)propyl]-N,2,2-trimethylpropan-1-amine
N-[3-(hydroxy-methylidene-oxo-λ6-sulfanyl)propyl]-N,2,2-trimethylpropan-1-amine (PubChem CID 158256808) has the molecular formula C10H23NO2S
and a molecular weight of 221.37 g/mol. Its IUPAC name is N-[3-(hydroxy-methylidene-oxo-λ6-sulfanyl)propyl]-N,2,2-trimethylpropan-1-amine.
Molecular Properties
| Compound Name | N-[3-(hydroxy-methylidene-oxo-λ6-sulfanyl)propyl]-N,2,2-trimethylpropan-1-amine |
| PubChem CID | 158256808 |
| Molecular Formula | C10H23NO2S |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | N-[3-(hydroxy-methylidene-oxo-λ6-sulfanyl)propyl]-N,2,2-trimethylpropan-1-amine |
| SMILES | C=S(=O)(O)CCCN(C)CC(C)(C)C |
| InChI | InChI=1S/C10H23NO2S/c1-10(2,3)9-11(4)7-6-8-14(5,12)13/h5-9H2,1-4H3,(H,12,13) |
| InChIKey | OZJXWFPSMDRFPG-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(hydroxy-methylidene-oxo-λ6-sulfanyl)propyl]-N,2,2-trimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(hydroxy-methylidene-oxo-λ6-sulfanyl)propyl]-N,2,2-trimethylpropan-1-amine?
The IUPAC name of N-[3-(hydroxy-methylidene-oxo-λ6-sulfanyl)propyl]-N,2,2-trimethylpropan-1-amine (CID 158256808) is N-[3-(hydroxy-methylidene-oxo-λ6-sulfanyl)propyl]-N,2,2-trimethylpropan-1-amine.
What is the SMILES notation for N-[3-(hydroxy-methylidene-oxo-λ6-sulfanyl)propyl]-N,2,2-trimethylpropan-1-amine?
The canonical SMILES for N-[3-(hydroxy-methylidene-oxo-λ6-sulfanyl)propyl]-N,2,2-trimethylpropan-1-amine is C=S(=O)(O)CCCN(C)CC(C)(C)C.
What is the InChIKey of N-[3-(hydroxy-methylidene-oxo-λ6-sulfanyl)propyl]-N,2,2-trimethylpropan-1-amine?
The InChIKey is OZJXWFPSMDRFPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23NO2S/c1-10(2,3)9-11(4)7-6-8-14(5,12)13/h5-9H2,1-4H3,(H,12,13).
What are the key properties of N-[3-(hydroxy-methylidene-oxo-λ6-sulfanyl)propyl]-N,2,2-trimethylpropan-1-amine?
N-[3-(hydroxy-methylidene-oxo-λ6-sulfanyl)propyl]-N,2,2-trimethylpropan-1-amine has a molecular weight of 221.37 g/mol, XLogP of 1.54, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(hydroxy-methylidene-oxo-λ6-sulfanyl)propyl]-N,2,2-trimethylpropan-1-amine is sourced from PubChem (CID 158256808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).