About lithium;1-methoxy-2-methylpentane;3-methoxy-2-methylpropane-1-thiolate
lithium;1-methoxy-2-methylpentane;3-methoxy-2-methylpropane-1-thiolate (PubChem CID 158258669) has the molecular formula C12H27LiO2S
and a molecular weight of 242.35 g/mol. Its IUPAC name is lithium;1-methoxy-2-methylpentane;3-methoxy-2-methylpropane-1-thiolate.
Molecular Properties
| Compound Name | lithium;1-methoxy-2-methylpentane;3-methoxy-2-methylpropane-1-thiolate |
| PubChem CID | 158258669 |
| Molecular Formula | C12H27LiO2S |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | lithium;1-methoxy-2-methylpentane;3-methoxy-2-methylpropane-1-thiolate |
| SMILES | CCCC(C)COC.COCC(C)C[S-].[Li+] |
| InChI | InChI=1S/C7H16O.C5H12OS.Li/c1-4-5-7(2)6-8-3;1-5(4-7)3-6-2;/h7H,4-6H2,1-3H3;5,7H,3-4H2,1-2H3;/q;;+1/p-1 |
| InChIKey | GHPHCXMOLOHTHV-UHFFFAOYSA-M |
| XLogP | -0.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze lithium;1-methoxy-2-methylpentane;3-methoxy-2-methylpropane-1-thiolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;1-methoxy-2-methylpentane;3-methoxy-2-methylpropane-1-thiolate?
The IUPAC name of lithium;1-methoxy-2-methylpentane;3-methoxy-2-methylpropane-1-thiolate (CID 158258669) is lithium;1-methoxy-2-methylpentane;3-methoxy-2-methylpropane-1-thiolate.
What is the SMILES notation for lithium;1-methoxy-2-methylpentane;3-methoxy-2-methylpropane-1-thiolate?
The canonical SMILES for lithium;1-methoxy-2-methylpentane;3-methoxy-2-methylpropane-1-thiolate is CCCC(C)COC.COCC(C)C[S-].[Li+].
What is the InChIKey of lithium;1-methoxy-2-methylpentane;3-methoxy-2-methylpropane-1-thiolate?
The InChIKey is GHPHCXMOLOHTHV-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H16O.C5H12OS.Li/c1-4-5-7(2)6-8-3;1-5(4-7)3-6-2;/h7H,4-6H2,1-3H3;5,7H,3-4H2,1-2H3;/q;;+1/p-1.
What are the key properties of lithium;1-methoxy-2-methylpentane;3-methoxy-2-methylpropane-1-thiolate?
lithium;1-methoxy-2-methylpentane;3-methoxy-2-methylpropane-1-thiolate has a molecular weight of 242.35 g/mol, XLogP of -0.11, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;1-methoxy-2-methylpentane;3-methoxy-2-methylpropane-1-thiolate is sourced from PubChem (CID 158258669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).