About 2-methylpentyl hypofluorite
2-methylpentyl hypofluorite (PubChem CID 164530616) has the molecular formula C6H13FO
and a molecular weight of 120.17 g/mol. Its IUPAC name is 2-methylpentyl hypofluorite.
Molecular Properties
| Compound Name | 2-methylpentyl hypofluorite |
| PubChem CID | 164530616 |
| Molecular Formula | C6H13FO |
| Molecular Weight | 120.17 g/mol |
| Exact Mass | 120.10 |
| IUPAC Name | 2-methylpentyl hypofluorite |
| SMILES | CCCC(C)COF |
| InChI | InChI=1S/C6H13FO/c1-3-4-6(2)5-8-7/h6H,3-5H2,1-2H3 |
| InChIKey | YWMQVYWOOQQKQD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.17 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methylpentyl hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpentyl hypofluorite?
The IUPAC name of 2-methylpentyl hypofluorite (CID 164530616) is 2-methylpentyl hypofluorite.
What is the SMILES notation for 2-methylpentyl hypofluorite?
The canonical SMILES for 2-methylpentyl hypofluorite is CCCC(C)COF.
What is the InChIKey of 2-methylpentyl hypofluorite?
The InChIKey is YWMQVYWOOQQKQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13FO/c1-3-4-6(2)5-8-7/h6H,3-5H2,1-2H3.
What are the key properties of 2-methylpentyl hypofluorite?
2-methylpentyl hypofluorite has a molecular weight of 120.17 g/mol, XLogP of 2.32, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpentyl hypofluorite is sourced from PubChem (CID 164530616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).