About 2-methylpentyl carbonofluoridate
2-methylpentyl carbonofluoridate (PubChem CID 175528242) has the molecular formula C7H13FO2
and a molecular weight of 148.18 g/mol. Its IUPAC name is 2-methylpentyl carbonofluoridate.
Molecular Properties
| Compound Name | 2-methylpentyl carbonofluoridate |
| PubChem CID | 175528242 |
| Molecular Formula | C7H13FO2 |
| Molecular Weight | 148.18 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 2-methylpentyl carbonofluoridate |
| SMILES | CCCC(C)COC(=O)F |
| InChI | InChI=1S/C7H13FO2/c1-3-4-6(2)5-10-7(8)9/h6H,3-5H2,1-2H3 |
| InChIKey | IKQDRESIFQSMES-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.18 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpentyl carbonofluoridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpentyl carbonofluoridate?
The IUPAC name of 2-methylpentyl carbonofluoridate (CID 175528242) is 2-methylpentyl carbonofluoridate.
What is the SMILES notation for 2-methylpentyl carbonofluoridate?
The canonical SMILES for 2-methylpentyl carbonofluoridate is CCCC(C)COC(=O)F.
What is the InChIKey of 2-methylpentyl carbonofluoridate?
The InChIKey is IKQDRESIFQSMES-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13FO2/c1-3-4-6(2)5-10-7(8)9/h6H,3-5H2,1-2H3.
What are the key properties of 2-methylpentyl carbonofluoridate?
2-methylpentyl carbonofluoridate has a molecular weight of 148.18 g/mol, XLogP of 2.53, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpentyl carbonofluoridate is sourced from PubChem (CID 175528242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).