About 2-iodopropyl carbonofluoridate
2-iodopropyl carbonofluoridate (PubChem CID 118465559) has the molecular formula C4H6FIO2
and a molecular weight of 231.99 g/mol. Its IUPAC name is 2-iodopropyl carbonofluoridate.
Molecular Properties
| Compound Name | 2-iodopropyl carbonofluoridate |
| PubChem CID | 118465559 |
| Molecular Formula | C4H6FIO2 |
| Molecular Weight | 231.99 g/mol |
| Exact Mass | 231.94 |
| IUPAC Name | 2-iodopropyl carbonofluoridate |
| SMILES | CC(I)COC(=O)F |
| InChI | InChI=1S/C4H6FIO2/c1-3(6)2-8-4(5)7/h3H,2H2,1H3 |
| InChIKey | BTZNYXOSGMQMLX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.99 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-iodopropyl carbonofluoridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodopropyl carbonofluoridate?
The IUPAC name of 2-iodopropyl carbonofluoridate (CID 118465559) is 2-iodopropyl carbonofluoridate.
What is the SMILES notation for 2-iodopropyl carbonofluoridate?
The canonical SMILES for 2-iodopropyl carbonofluoridate is CC(I)COC(=O)F.
What is the InChIKey of 2-iodopropyl carbonofluoridate?
The InChIKey is BTZNYXOSGMQMLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6FIO2/c1-3(6)2-8-4(5)7/h3H,2H2,1H3.
What are the key properties of 2-iodopropyl carbonofluoridate?
2-iodopropyl carbonofluoridate has a molecular weight of 231.99 g/mol, XLogP of 1.92, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodopropyl carbonofluoridate is sourced from PubChem (CID 118465559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).