About bis(carbonofluoridic acid);fluoromethyl carbonofluoridate
bis(carbonofluoridic acid);fluoromethyl carbonofluoridate (PubChem CID 175227827) has the molecular formula C4H4F4O6
and a molecular weight of 224.06 g/mol. Its IUPAC name is bis(carbonofluoridic acid);fluoromethyl carbonofluoridate.
Molecular Properties
| Compound Name | bis(carbonofluoridic acid);fluoromethyl carbonofluoridate |
| PubChem CID | 175227827 |
| Molecular Formula | C4H4F4O6 |
| Molecular Weight | 224.06 g/mol |
| Exact Mass | 223.99 |
| IUPAC Name | bis(carbonofluoridic acid);fluoromethyl carbonofluoridate |
| SMILES | O=C(F)OCF.O=C(O)F.O=C(O)F |
| InChI | InChI=1S/C2H2F2O2.2CHFO2/c3-1-6-2(4)5;2*2-1(3)4/h1H2;2*(H,3,4) |
| InChIKey | OCRQOUXFPBJZJW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.06 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze bis(carbonofluoridic acid);fluoromethyl carbonofluoridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(carbonofluoridic acid);fluoromethyl carbonofluoridate?
The IUPAC name of bis(carbonofluoridic acid);fluoromethyl carbonofluoridate (CID 175227827) is bis(carbonofluoridic acid);fluoromethyl carbonofluoridate.
What is the SMILES notation for bis(carbonofluoridic acid);fluoromethyl carbonofluoridate?
The canonical SMILES for bis(carbonofluoridic acid);fluoromethyl carbonofluoridate is O=C(F)OCF.O=C(O)F.O=C(O)F.
What is the InChIKey of bis(carbonofluoridic acid);fluoromethyl carbonofluoridate?
The InChIKey is OCRQOUXFPBJZJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2F2O2.2CHFO2/c3-1-6-2(4)5;2*2-1(3)4/h1H2;2*(H,3,4).
What are the key properties of bis(carbonofluoridic acid);fluoromethyl carbonofluoridate?
bis(carbonofluoridic acid);fluoromethyl carbonofluoridate has a molecular weight of 224.06 g/mol, XLogP of 2.29, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(carbonofluoridic acid);fluoromethyl carbonofluoridate is sourced from PubChem (CID 175227827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).