C4H4F8O3S — CID 159307063
difluoromethane;sulfuryl difluoride;1,1,2-trifluoro-2-(fluoromethoxy)ethene (PubChem CID 159307063) has the molecular formula C4H4F8O3S and a molecular weight of 284.12 g/mol. Its IUPAC name is difluoromethane;sulfuryl difluoride;1,1,2-trifluoro-2-(fluoromethoxy)ethene.
| Compound Name | difluoromethane;sulfuryl difluoride;1,1,2-trifluoro-2-(fluoromethoxy)ethene |
|---|---|
| PubChem CID | 159307063 |
| Molecular Formula | C4H4F8O3S |
| Molecular Weight | 284.12 g/mol |
| Exact Mass | 283.98 |
| IUPAC Name | difluoromethane;sulfuryl difluoride;1,1,2-trifluoro-2-(fluoromethoxy)ethene |
| SMILES | FCF.FCOC(F)=C(F)F.O=S(=O)(F)F |
| InChI | InChI=1S/C3H2F4O.CH2F2.F2O2S/c4-1-8-3(7)2(5)6;2-1-3;1-5(2,3)4/h1H2;1H2; |
| InChIKey | LCAYANXDLVQPGC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.12 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|